C19H24N6OS — CID 10452621
N-[(E)-[amino-(6-phenylmethoxypyrazin-2-yl)methylidene]amino]azepane-1-carbothioamide (PubChem CID 10452621) has the molecular formula C19H24N6OS and a molecular weight of 384.51 g/mol. Its IUPAC name is N-[(E)-[amino-(6-phenylmethoxypyrazin-2-yl)methylidene]amino]azepane-1-carbothioamide.
| Compound Name | N-[(E)-[amino-(6-phenylmethoxypyrazin-2-yl)methylidene]amino]azepane-1-carbothioamide |
|---|---|
| PubChem CID | 10452621 |
| Molecular Formula | C19H24N6OS |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-[(E)-[amino-(6-phenylmethoxypyrazin-2-yl)methylidene]amino]azepane-1-carbothioamide |
| SMILES | N/C(=N/NC(=S)N1CCCCCC1)c1cncc(OCc2ccccc2)n1 |
| InChI | InChI=1S/C19H24N6OS/c20-18(23-24-19(27)25-10-6-1-2-7-11-25)16-12-21-13-17(22-16)26-14-15-8-4-3-5-9-15/h3-5,8-9,12-13H,1-2,6-7,10-11,14H2,(H2,20,23)(H,24,27) |
| InChIKey | GITZZISYUNTCOA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|