C11H16N6OS — CID 170856146
N-[(Z)-[amino-(6-methoxypyrazin-2-yl)methylidene]amino]pyrrolidine-1-carbothioamide (PubChem CID 170856146) has the molecular formula C11H16N6OS and a molecular weight of 280.36 g/mol. Its IUPAC name is N-[(Z)-[amino-(6-methoxypyrazin-2-yl)methylidene]amino]pyrrolidine-1-carbothioamide.
| Compound Name | N-[(Z)-[amino-(6-methoxypyrazin-2-yl)methylidene]amino]pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 170856146 |
| Molecular Formula | C11H16N6OS |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | N-[(Z)-[amino-(6-methoxypyrazin-2-yl)methylidene]amino]pyrrolidine-1-carbothioamide |
| SMILES | COc1cncc(/C(N)=N/NC(=S)N2CCCC2)n1 |
| InChI | InChI=1S/C11H16N6OS/c1-18-9-7-13-6-8(14-9)10(12)15-16-11(19)17-4-2-3-5-17/h6-7H,2-5H2,1H3,(H2,12,15)(H,16,19) |
| InChIKey | SOYSDLUIPJQTMR-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|