C21H19N5O3 — CID 170856292
2-(3,4-dimethoxyphenyl)-2-[6-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]pyrazin-2-yl]acetonitrile (PubChem CID 170856292) has the molecular formula C21H19N5O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-2-[6-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]pyrazin-2-yl]acetonitrile.
| Compound Name | 2-(3,4-dimethoxyphenyl)-2-[6-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]pyrazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 170856292 |
| Molecular Formula | C21H19N5O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-2-[6-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]pyrazin-2-yl]acetonitrile |
| SMILES | COc1ccc(C(C#N)c2cncc(N/N=C/c3ccccc3O)n2)cc1OC |
| InChI | InChI=1S/C21H19N5O3/c1-28-19-8-7-14(9-20(19)29-2)16(10-22)17-12-23-13-21(25-17)26-24-11-15-5-3-4-6-18(15)27/h3-9,11-13,16,27H,1-2H3,(H,25,26)/b24-11+ |
| InChIKey | FQKGIYDMITVVJO-BHGWPJFGSA-N |
| XLogP | 3.30 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|