C24H25N5O5 — CID 170856333
2-(3,4-dimethoxyphenyl)-2-[6-[(2E)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]pyrazin-2-yl]acetonitrile (PubChem CID 170856333) has the molecular formula C24H25N5O5 and a molecular weight of 463.49 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-2-[6-[(2E)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]pyrazin-2-yl]acetonitrile.
| Compound Name | 2-(3,4-dimethoxyphenyl)-2-[6-[(2E)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]pyrazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 170856333 |
| Molecular Formula | C24H25N5O5 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-2-[6-[(2E)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]pyrazin-2-yl]acetonitrile |
| SMILES | COc1ccc(C(C#N)c2cncc(N/N=C/c3cc(OC)c(OC)c(OC)c3)n2)cc1OC |
| InChI | InChI=1S/C24H25N5O5/c1-30-19-7-6-16(10-20(19)31-2)17(11-25)18-13-26-14-23(28-18)29-27-12-15-8-21(32-3)24(34-5)22(9-15)33-4/h6-10,12-14,17H,1-5H3,(H,28,29)/b27-12+ |
| InChIKey | CMTBMNKVHSWIDS-KKMKTNMSSA-N |
| XLogP | 3.62 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|