C11H23NO3 — CID 170856935
4-(1,3-diethoxypropan-2-yl)morpholine (PubChem CID 170856935) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is 4-(1,3-diethoxypropan-2-yl)morpholine.
| Compound Name | 4-(1,3-diethoxypropan-2-yl)morpholine |
|---|---|
| PubChem CID | 170856935 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | 4-(1,3-diethoxypropan-2-yl)morpholine |
| SMILES | CCOCC(COCC)N1CCOCC1 |
| InChI | InChI=1S/C11H23NO3/c1-3-13-9-11(10-14-4-2)12-5-7-15-8-6-12/h11H,3-10H2,1-2H3 |
| InChIKey | AKQDHHSJWBGBBJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |