C17H20N2O4 — CID 170857810
(6-methyl-1H-indazol-3-yl)-(2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl)methanone (PubChem CID 170857810) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is (6-methyl-1H-indazol-3-yl)-(2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl)methanone.
| Compound Name | (6-methyl-1H-indazol-3-yl)-(2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl)methanone |
|---|---|
| PubChem CID | 170857810 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (6-methyl-1H-indazol-3-yl)-(2,2,6-trimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl)methanone |
| SMILES | Cc1ccc2c(C(=O)C3OC(C)C4OC(C)(C)OC34)n[nH]c2c1 |
| InChI | InChI=1S/C17H20N2O4/c1-8-5-6-10-11(7-8)18-19-12(10)13(20)15-16-14(9(2)21-15)22-17(3,4)23-16/h5-7,9,14-16H,1-4H3,(H,18,19) |
| InChIKey | OFDUFMWICRXGDY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |