C25H30N4O2 — CID 170859570
11-[3-(4-methylpiperazin-1-yl)propyl]-5-prop-2-enylbenzo[c][1,5]benzodiazocine-6,12-dione (PubChem CID 170859570) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 11-[3-(4-methylpiperazin-1-yl)propyl]-5-prop-2-enylbenzo[c][1,5]benzodiazocine-6,12-dione.
| Compound Name | 11-[3-(4-methylpiperazin-1-yl)propyl]-5-prop-2-enylbenzo[c][1,5]benzodiazocine-6,12-dione |
|---|---|
| PubChem CID | 170859570 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 11-[3-(4-methylpiperazin-1-yl)propyl]-5-prop-2-enylbenzo[c][1,5]benzodiazocine-6,12-dione |
| SMILES | C=CCN1C(=O)c2ccccc2N(CCCN2CCN(C)CC2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C25H30N4O2/c1-3-13-28-22-11-6-4-9-20(22)25(31)29(23-12-7-5-10-21(23)24(28)30)15-8-14-27-18-16-26(2)17-19-27/h3-7,9-12H,1,8,13-19H2,2H3 |
| InChIKey | WLHHTYNYMUFNMU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|