C26H39N5O2 — CID 170862787
1-methyl-4-[3-[3-[3-(4-methylpiperazin-1-yl)propyl]-5-nitronaphthalen-2-yl]propyl]piperazine (PubChem CID 170862787) has the molecular formula C26H39N5O2 and a molecular weight of 453.63 g/mol. Its IUPAC name is 1-methyl-4-[3-[3-[3-(4-methylpiperazin-1-yl)propyl]-5-nitronaphthalen-2-yl]propyl]piperazine.
| Compound Name | 1-methyl-4-[3-[3-[3-(4-methylpiperazin-1-yl)propyl]-5-nitronaphthalen-2-yl]propyl]piperazine |
|---|---|
| PubChem CID | 170862787 |
| Molecular Formula | C26H39N5O2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.31 |
| IUPAC Name | 1-methyl-4-[3-[3-[3-(4-methylpiperazin-1-yl)propyl]-5-nitronaphthalen-2-yl]propyl]piperazine |
| SMILES | CN1CCN(CCCc2cc3cccc([N+](=O)[O-])c3cc2CCCN2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C26H39N5O2/c1-27-12-16-29(17-13-27)10-4-7-22-20-24-6-3-9-26(31(32)33)25(24)21-23(22)8-5-11-30-18-14-28(2)15-19-30/h3,6,9,20-21H,4-5,7-8,10-19H2,1-2H3 |
| InChIKey | SLYQLISDKUGXJZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 56.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|