C20H35N3O — CID 170863629
3-ethoxy-N,N-diethyl-4-[3-(4-methylpiperazin-1-yl)propyl]aniline (PubChem CID 170863629) has the molecular formula C20H35N3O and a molecular weight of 333.52 g/mol. Its IUPAC name is 3-ethoxy-N,N-diethyl-4-[3-(4-methylpiperazin-1-yl)propyl]aniline.
| Compound Name | 3-ethoxy-N,N-diethyl-4-[3-(4-methylpiperazin-1-yl)propyl]aniline |
|---|---|
| PubChem CID | 170863629 |
| Molecular Formula | C20H35N3O |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.28 |
| IUPAC Name | 3-ethoxy-N,N-diethyl-4-[3-(4-methylpiperazin-1-yl)propyl]aniline |
| SMILES | CCOc1cc(N(CC)CC)ccc1CCCN1CCN(C)CC1 |
| InChI | InChI=1S/C20H35N3O/c1-5-23(6-2)19-11-10-18(20(17-19)24-7-3)9-8-12-22-15-13-21(4)14-16-22/h10-11,17H,5-9,12-16H2,1-4H3 |
| InChIKey | VEQAGQQVXDTGDG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |