C18H30N2O2 — CID 170869897
N,N-diethyl-3-methoxy-4-(3-morpholin-4-ylpropyl)aniline (PubChem CID 170869897) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is N,N-diethyl-3-methoxy-4-(3-morpholin-4-ylpropyl)aniline.
| Compound Name | N,N-diethyl-3-methoxy-4-(3-morpholin-4-ylpropyl)aniline |
|---|---|
| PubChem CID | 170869897 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | N,N-diethyl-3-methoxy-4-(3-morpholin-4-ylpropyl)aniline |
| SMILES | CCN(CC)c1ccc(CCCN2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C18H30N2O2/c1-4-20(5-2)17-9-8-16(18(15-17)21-3)7-6-10-19-11-13-22-14-12-19/h8-9,15H,4-7,10-14H2,1-3H3 |
| InChIKey | APBOYRRLQWFYCX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |