C11H14Cl2N2O2 — CID 170865387
3-(2,6-dichloro-3-nitrophenyl)-N,N-dimethylpropan-1-amine (PubChem CID 170865387) has the molecular formula C11H14Cl2N2O2 and a molecular weight of 277.15 g/mol. Its IUPAC name is 3-(2,6-dichloro-3-nitrophenyl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(2,6-dichloro-3-nitrophenyl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 170865387 |
| Molecular Formula | C11H14Cl2N2O2 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 3-(2,6-dichloro-3-nitrophenyl)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCc1c(Cl)ccc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C11H14Cl2N2O2/c1-14(2)7-3-4-8-9(12)5-6-10(11(8)13)15(16)17/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | GQIFODHBJWVDQY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|