C8H10Cl2N2O — CID 170868268
2-(3-aminopropyl)-3,6-dichloro-1H-pyridin-4-one (PubChem CID 170868268) has the molecular formula C8H10Cl2N2O and a molecular weight of 221.09 g/mol. Its IUPAC name is 2-(3-aminopropyl)-3,6-dichloro-1H-pyridin-4-one.
| Compound Name | 2-(3-aminopropyl)-3,6-dichloro-1H-pyridin-4-one |
|---|---|
| PubChem CID | 170868268 |
| Molecular Formula | C8H10Cl2N2O |
| Molecular Weight | 221.09 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 2-(3-aminopropyl)-3,6-dichloro-1H-pyridin-4-one |
| SMILES | NCCCc1[nH]c(Cl)cc(=O)c1Cl |
| InChI | InChI=1S/C8H10Cl2N2O/c9-7-4-6(13)8(10)5(12-7)2-1-3-11/h4H,1-3,11H2,(H,12,13) |
| InChIKey | GSBZNXULRWAZGY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.09 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|