About [4-(propanoylamino)phenyl] 2-fluorobenzoate
[4-(propanoylamino)phenyl] 2-fluorobenzoate (PubChem CID 17087286) has the molecular formula C16H14FNO3
and a molecular weight of 287.29 g/mol. Its IUPAC name is [4-(propanoylamino)phenyl] 2-fluorobenzoate.
Molecular Properties
| Compound Name | [4-(propanoylamino)phenyl] 2-fluorobenzoate |
| PubChem CID | 17087286 |
| Molecular Formula | C16H14FNO3 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | [4-(propanoylamino)phenyl] 2-fluorobenzoate |
| SMILES | CCC(=O)Nc1ccc(OC(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C16H14FNO3/c1-2-15(19)18-11-7-9-12(10-8-11)21-16(20)13-5-3-4-6-14(13)17/h3-10H,2H2,1H3,(H,18,19) |
| InChIKey | HRDUSVROMXGLTJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(propanoylamino)phenyl] 2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(propanoylamino)phenyl] 2-fluorobenzoate?
The IUPAC name of [4-(propanoylamino)phenyl] 2-fluorobenzoate (CID 17087286) is [4-(propanoylamino)phenyl] 2-fluorobenzoate.
What is the SMILES notation for [4-(propanoylamino)phenyl] 2-fluorobenzoate?
The canonical SMILES for [4-(propanoylamino)phenyl] 2-fluorobenzoate is CCC(=O)Nc1ccc(OC(=O)c2ccccc2F)cc1.
What is the InChIKey of [4-(propanoylamino)phenyl] 2-fluorobenzoate?
The InChIKey is HRDUSVROMXGLTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FNO3/c1-2-15(19)18-11-7-9-12(10-8-11)21-16(20)13-5-3-4-6-14(13)17/h3-10H,2H2,1H3,(H,18,19).
What are the key properties of [4-(propanoylamino)phenyl] 2-fluorobenzoate?
[4-(propanoylamino)phenyl] 2-fluorobenzoate has a molecular weight of 287.29 g/mol, XLogP of 3.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(propanoylamino)phenyl] 2-fluorobenzoate is sourced from PubChem (CID 17087286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).