About 1-bromo-3,5-dichloro-2-methoxybenzene
1-bromo-3,5-dichloro-2-methoxybenzene (PubChem CID 17087326) has the molecular formula C7H5BrCl2O
and a molecular weight of 255.93 g/mol. Its IUPAC name is 1-bromo-3,5-dichloro-2-methoxybenzene.
Molecular Properties
| Compound Name | 1-bromo-3,5-dichloro-2-methoxybenzene |
| PubChem CID | 17087326 |
| Molecular Formula | C7H5BrCl2O |
| Molecular Weight | 255.93 g/mol |
| Exact Mass | 253.89 |
| IUPAC Name | 1-bromo-3,5-dichloro-2-methoxybenzene |
| SMILES | COc1c(Cl)cc(Cl)cc1Br |
| InChI | InChI=1S/C7H5BrCl2O/c1-11-7-5(8)2-4(9)3-6(7)10/h2-3H,1H3 |
| InChIKey | OEYKUHBCPJRXGZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.93 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-3,5-dichloro-2-methoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3,5-dichloro-2-methoxybenzene?
The IUPAC name of 1-bromo-3,5-dichloro-2-methoxybenzene (CID 17087326) is 1-bromo-3,5-dichloro-2-methoxybenzene.
What is the SMILES notation for 1-bromo-3,5-dichloro-2-methoxybenzene?
The canonical SMILES for 1-bromo-3,5-dichloro-2-methoxybenzene is COc1c(Cl)cc(Cl)cc1Br.
What is the InChIKey of 1-bromo-3,5-dichloro-2-methoxybenzene?
The InChIKey is OEYKUHBCPJRXGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrCl2O/c1-11-7-5(8)2-4(9)3-6(7)10/h2-3H,1H3.
What are the key properties of 1-bromo-3,5-dichloro-2-methoxybenzene?
1-bromo-3,5-dichloro-2-methoxybenzene has a molecular weight of 255.93 g/mol, XLogP of 3.76, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3,5-dichloro-2-methoxybenzene is sourced from PubChem (CID 17087326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).