C19H23N3O4S — CID 17087369
methyl 3-[[4-[(3-methoxyphenyl)methyl]piperazine-1-carbonyl]amino]thiophene-2-carboxylate (PubChem CID 17087369) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is methyl 3-[[4-[(3-methoxyphenyl)methyl]piperazine-1-carbonyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[4-[(3-methoxyphenyl)methyl]piperazine-1-carbonyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 17087369 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | methyl 3-[[4-[(3-methoxyphenyl)methyl]piperazine-1-carbonyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)N1CCN(Cc2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C19H23N3O4S/c1-25-15-5-3-4-14(12-15)13-21-7-9-22(10-8-21)19(24)20-16-6-11-27-17(16)18(23)26-2/h3-6,11-12H,7-10,13H2,1-2H3,(H,20,24) |
| InChIKey | XXXXFNZMCOMWPP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |