C13H14ClNO6 — CID 170873978
2-[(4-chloro-2-nitrophenyl)-(1,3-dioxolan-2-yl)methyl]-1,3-dioxolane (PubChem CID 170873978) has the molecular formula C13H14ClNO6 and a molecular weight of 315.71 g/mol. Its IUPAC name is 2-[(4-chloro-2-nitrophenyl)-(1,3-dioxolan-2-yl)methyl]-1,3-dioxolane.
| Compound Name | 2-[(4-chloro-2-nitrophenyl)-(1,3-dioxolan-2-yl)methyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 170873978 |
| Molecular Formula | C13H14ClNO6 |
| Molecular Weight | 315.71 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 2-[(4-chloro-2-nitrophenyl)-(1,3-dioxolan-2-yl)methyl]-1,3-dioxolane |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1C(C1OCCO1)C1OCCO1 |
| InChI | InChI=1S/C13H14ClNO6/c14-8-1-2-9(10(7-8)15(16)17)11(12-18-3-4-19-12)13-20-5-6-21-13/h1-2,7,11-13H,3-6H2 |
| InChIKey | ZZRZYVHBXURWTF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.71 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|