C16H13BrF2N2O3 — CID 170876053
[4-bromo-2-(1,3-diamino-3-oxopropyl)phenyl] 2,6-difluorobenzoate (PubChem CID 170876053) has the molecular formula C16H13BrF2N2O3 and a molecular weight of 399.19 g/mol. Its IUPAC name is [4-bromo-2-(1,3-diamino-3-oxopropyl)phenyl] 2,6-difluorobenzoate.
| Compound Name | [4-bromo-2-(1,3-diamino-3-oxopropyl)phenyl] 2,6-difluorobenzoate |
|---|---|
| PubChem CID | 170876053 |
| Molecular Formula | C16H13BrF2N2O3 |
| Molecular Weight | 399.19 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | [4-bromo-2-(1,3-diamino-3-oxopropyl)phenyl] 2,6-difluorobenzoate |
| SMILES | NC(=O)CC(N)c1cc(Br)ccc1OC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C16H13BrF2N2O3/c17-8-4-5-13(9(6-8)12(20)7-14(21)22)24-16(23)15-10(18)2-1-3-11(15)19/h1-6,12H,7,20H2,(H2,21,22) |
| InChIKey | RWYSTVMHNMUHEH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.19 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|