C22H28FN3O — CID 17087629
N-(3-fluoro-4-methylphenyl)-4-[(4-propan-2-ylphenyl)methyl]piperazine-1-carboxamide (PubChem CID 17087629) has the molecular formula C22H28FN3O and a molecular weight of 369.48 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-4-[(4-propan-2-ylphenyl)methyl]piperazine-1-carboxamide.
| Compound Name | N-(3-fluoro-4-methylphenyl)-4-[(4-propan-2-ylphenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 17087629 |
| Molecular Formula | C22H28FN3O |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-4-[(4-propan-2-ylphenyl)methyl]piperazine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCN(Cc3ccc(C(C)C)cc3)CC2)cc1F |
| InChI | InChI=1S/C22H28FN3O/c1-16(2)19-7-5-18(6-8-19)15-25-10-12-26(13-11-25)22(27)24-20-9-4-17(3)21(23)14-20/h4-9,14,16H,10-13,15H2,1-3H3,(H,24,27) |
| InChIKey | YHBCTAHNCNJVEU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |