C23H31N3O2 — CID 70944767
4-[[4-[2-(4-propan-2-ylanilino)ethyl]phenyl]methyl]piperazine-1-carboxylic acid (PubChem CID 70944767) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 4-[[4-[2-(4-propan-2-ylanilino)ethyl]phenyl]methyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[[4-[2-(4-propan-2-ylanilino)ethyl]phenyl]methyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 70944767 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 4-[[4-[2-(4-propan-2-ylanilino)ethyl]phenyl]methyl]piperazine-1-carboxylic acid |
| SMILES | CC(C)c1ccc(NCCc2ccc(CN3CCN(C(=O)O)CC3)cc2)cc1 |
| InChI | InChI=1S/C23H31N3O2/c1-18(2)21-7-9-22(10-8-21)24-12-11-19-3-5-20(6-4-19)17-25-13-15-26(16-14-25)23(27)28/h3-10,18,24H,11-17H2,1-2H3,(H,27,28) |
| InChIKey | POTIUORZPKHSAY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |