C15H19NO3 — CID 170877017
(Z)-3-[4-(2-methoxyphenyl)oxan-4-yl]prop-2-enamide (PubChem CID 170877017) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is (Z)-3-[4-(2-methoxyphenyl)oxan-4-yl]prop-2-enamide.
| Compound Name | (Z)-3-[4-(2-methoxyphenyl)oxan-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170877017 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (Z)-3-[4-(2-methoxyphenyl)oxan-4-yl]prop-2-enamide |
| SMILES | COc1ccccc1C1(/C=C\C(N)=O)CCOCC1 |
| InChI | InChI=1S/C15H19NO3/c1-18-13-5-3-2-4-12(13)15(7-6-14(16)17)8-10-19-11-9-15/h2-7H,8-11H2,1H3,(H2,16,17)/b7-6- |
| InChIKey | UAHQAEQGUBKPIQ-SREVYHEPSA-N |
| XLogP | 1.78 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|