C15H18ClNO2 — CID 170878777
3-[5-[(3-chloro-2-methylphenoxy)methyl]furan-2-yl]propan-1-amine (PubChem CID 170878777) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is 3-[5-[(3-chloro-2-methylphenoxy)methyl]furan-2-yl]propan-1-amine.
| Compound Name | 3-[5-[(3-chloro-2-methylphenoxy)methyl]furan-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 170878777 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 3-[5-[(3-chloro-2-methylphenoxy)methyl]furan-2-yl]propan-1-amine |
| SMILES | Cc1c(Cl)cccc1OCc1ccc(CCCN)o1 |
| InChI | InChI=1S/C15H18ClNO2/c1-11-14(16)5-2-6-15(11)18-10-13-8-7-12(19-13)4-3-9-17/h2,5-8H,3-4,9-10,17H2,1H3 |
| InChIKey | KGNVICUVVULKII-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |