C20H18F3N5OS — CID 17088060
3-methyl-6-(4-methylphenyl)-N-[3-(trifluoromethyl)phenyl]-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide (PubChem CID 17088060) has the molecular formula C20H18F3N5OS and a molecular weight of 433.46 g/mol. Its IUPAC name is 3-methyl-6-(4-methylphenyl)-N-[3-(trifluoromethyl)phenyl]-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide.
| Compound Name | 3-methyl-6-(4-methylphenyl)-N-[3-(trifluoromethyl)phenyl]-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 17088060 |
| Molecular Formula | C20H18F3N5OS |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 3-methyl-6-(4-methylphenyl)-N-[3-(trifluoromethyl)phenyl]-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
| SMILES | Cc1ccc(C2Nn3c(C)nnc3SC2C(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H18F3N5OS/c1-11-6-8-13(9-7-11)16-17(30-19-26-25-12(2)28(19)27-16)18(29)24-15-5-3-4-14(10-15)20(21,22)23/h3-10,16-17,27H,1-2H3,(H,24,29) |
| InChIKey | WUKCNUBVAXTMPB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |