C22H22F3N5OS — CID 17096358
3-ethyl-6-(4-ethylphenyl)-N-[3-(trifluoromethyl)phenyl]-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide (PubChem CID 17096358) has the molecular formula C22H22F3N5OS and a molecular weight of 461.51 g/mol. Its IUPAC name is 3-ethyl-6-(4-ethylphenyl)-N-[3-(trifluoromethyl)phenyl]-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide.
| Compound Name | 3-ethyl-6-(4-ethylphenyl)-N-[3-(trifluoromethyl)phenyl]-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 17096358 |
| Molecular Formula | C22H22F3N5OS |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 3-ethyl-6-(4-ethylphenyl)-N-[3-(trifluoromethyl)phenyl]-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
| SMILES | CCc1ccc(C2Nn3c(CC)nnc3SC2C(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H22F3N5OS/c1-3-13-8-10-14(11-9-13)18-19(32-21-28-27-17(4-2)30(21)29-18)20(31)26-16-7-5-6-15(12-16)22(23,24)25/h5-12,18-19,29H,3-4H2,1-2H3,(H,26,31) |
| InChIKey | PVBPNOIEYANPTO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |