C19H17ClFN5OS — CID 17096306
N-(3-chlorophenyl)-3-ethyl-6-(4-fluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide (PubChem CID 17096306) has the molecular formula C19H17ClFN5OS and a molecular weight of 417.90 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-ethyl-6-(4-fluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide.
| Compound Name | N-(3-chlorophenyl)-3-ethyl-6-(4-fluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 17096306 |
| Molecular Formula | C19H17ClFN5OS |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | N-(3-chlorophenyl)-3-ethyl-6-(4-fluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
| SMILES | CCc1nnc2n1NC(c1ccc(F)cc1)C(C(=O)Nc1cccc(Cl)c1)S2 |
| InChI | InChI=1S/C19H17ClFN5OS/c1-2-15-23-24-19-26(15)25-16(11-6-8-13(21)9-7-11)17(28-19)18(27)22-14-5-3-4-12(20)10-14/h3-10,16-17,25H,2H2,1H3,(H,22,27) |
| InChIKey | XMRWHMPIHPLRGP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |