C30H27ClN2O7 — CID 170882520
3-(2-chloro-5,6,7-trimethoxyquinolin-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 170882520) has the molecular formula C30H27ClN2O7 and a molecular weight of 563.01 g/mol. Its IUPAC name is 3-(2-chloro-5,6,7-trimethoxyquinolin-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-(2-chloro-5,6,7-trimethoxyquinolin-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 170882520 |
| Molecular Formula | C30H27ClN2O7 |
| Molecular Weight | 563.01 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | 3-(2-chloro-5,6,7-trimethoxyquinolin-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | COc1cc2nc(Cl)c(CC(NC(=O)OCC3c4ccccc4-c4ccccc43)C(=O)O)cc2c(OC)c1OC |
| InChI | InChI=1S/C30H27ClN2O7/c1-37-25-14-23-21(26(38-2)27(25)39-3)12-16(28(31)32-23)13-24(29(34)35)33-30(36)40-15-22-19-10-6-4-8-17(19)18-9-5-7-11-20(18)22/h4-12,14,22,24H,13,15H2,1-3H3,(H,33,36)(H,34,35) |
| InChIKey | IIAUKUJDTDSNHT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.01 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|