C34H34N2O4 — CID 170883272
3-[4-[benzyl(ethyl)amino]-2-methylphenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 170883272) has the molecular formula C34H34N2O4 and a molecular weight of 534.66 g/mol. Its IUPAC name is 3-[4-[benzyl(ethyl)amino]-2-methylphenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-[4-[benzyl(ethyl)amino]-2-methylphenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 170883272 |
| Molecular Formula | C34H34N2O4 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | 3-[4-[benzyl(ethyl)amino]-2-methylphenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | CCN(Cc1ccccc1)c1ccc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C34H34N2O4/c1-3-36(21-24-11-5-4-6-12-24)26-18-17-25(23(2)19-26)20-32(33(37)38)35-34(39)40-22-31-29-15-9-7-13-27(29)28-14-8-10-16-30(28)31/h4-19,31-32H,3,20-22H2,1-2H3,(H,35,39)(H,37,38) |
| InChIKey | JXKRCWKQKRVMHQ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|