C15H18N2O3 — CID 170884921
ethyl 2-amino-3-(5-methyl-3-phenyl-1,2-oxazol-4-yl)propanoate (PubChem CID 170884921) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is ethyl 2-amino-3-(5-methyl-3-phenyl-1,2-oxazol-4-yl)propanoate.
| Compound Name | ethyl 2-amino-3-(5-methyl-3-phenyl-1,2-oxazol-4-yl)propanoate |
|---|---|
| PubChem CID | 170884921 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | ethyl 2-amino-3-(5-methyl-3-phenyl-1,2-oxazol-4-yl)propanoate |
| SMILES | CCOC(=O)C(N)Cc1c(-c2ccccc2)noc1C |
| InChI | InChI=1S/C15H18N2O3/c1-3-19-15(18)13(16)9-12-10(2)20-17-14(12)11-7-5-4-6-8-11/h4-8,13H,3,9,16H2,1-2H3 |
| InChIKey | MPIXBDSTUIKKJY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |