C16H18BrNO4 — CID 170885411
ethyl 2-amino-3-[5-[(2-bromophenoxy)methyl]furan-2-yl]propanoate (PubChem CID 170885411) has the molecular formula C16H18BrNO4 and a molecular weight of 368.23 g/mol. Its IUPAC name is ethyl 2-amino-3-[5-[(2-bromophenoxy)methyl]furan-2-yl]propanoate.
| Compound Name | ethyl 2-amino-3-[5-[(2-bromophenoxy)methyl]furan-2-yl]propanoate |
|---|---|
| PubChem CID | 170885411 |
| Molecular Formula | C16H18BrNO4 |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | ethyl 2-amino-3-[5-[(2-bromophenoxy)methyl]furan-2-yl]propanoate |
| SMILES | CCOC(=O)C(N)Cc1ccc(COc2ccccc2Br)o1 |
| InChI | InChI=1S/C16H18BrNO4/c1-2-20-16(19)14(18)9-11-7-8-12(22-11)10-21-15-6-4-3-5-13(15)17/h3-8,14H,2,9-10,18H2,1H3 |
| InChIKey | RWOOGGSACSCRJL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |