C18H18BrNO3 — CID 35525159
5-[(2-bromophenoxy)methyl]-N,N-bis(prop-2-enyl)furan-2-carboxamide (PubChem CID 35525159) has the molecular formula C18H18BrNO3 and a molecular weight of 376.25 g/mol. Its IUPAC name is 5-[(2-bromophenoxy)methyl]-N,N-bis(prop-2-enyl)furan-2-carboxamide.
| Compound Name | 5-[(2-bromophenoxy)methyl]-N,N-bis(prop-2-enyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 35525159 |
| Molecular Formula | C18H18BrNO3 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 5-[(2-bromophenoxy)methyl]-N,N-bis(prop-2-enyl)furan-2-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1ccc(COc2ccccc2Br)o1 |
| InChI | InChI=1S/C18H18BrNO3/c1-3-11-20(12-4-2)18(21)17-10-9-14(23-17)13-22-16-8-6-5-7-15(16)19/h3-10H,1-2,11-13H2 |
| InChIKey | NCXJXUXFJMTKNI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|