C17H21BrN3O3+ — CID 4748985
5-[(2-bromophenoxy)methyl]-N-(4-methylpiperazin-4-ium-1-yl)furan-2-carboxamide (PubChem CID 4748985) has the molecular formula C17H21BrN3O3+ and a molecular weight of 395.28 g/mol. Its IUPAC name is 5-[(2-bromophenoxy)methyl]-N-(4-methylpiperazin-4-ium-1-yl)furan-2-carboxamide.
| Compound Name | 5-[(2-bromophenoxy)methyl]-N-(4-methylpiperazin-4-ium-1-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 4748985 |
| Molecular Formula | C17H21BrN3O3+ |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 5-[(2-bromophenoxy)methyl]-N-(4-methylpiperazin-4-ium-1-yl)furan-2-carboxamide |
| SMILES | C[NH+]1CCN(NC(=O)c2ccc(COc3ccccc3Br)o2)CC1 |
| InChI | InChI=1S/C17H20BrN3O3/c1-20-8-10-21(11-9-20)19-17(22)16-7-6-13(24-16)12-23-15-5-3-2-4-14(15)18/h2-7H,8-12H2,1H3,(H,19,22)/p+1 |
| InChIKey | BTIXOVJULJCUQC-UHFFFAOYSA-O |
| XLogP | 1.10 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |