C22H21BrN2O6S — CID 19450312
5-[(2-bromophenoxy)methyl]-N-(4-morpholin-4-ylsulfonylphenyl)furan-2-carboxamide (PubChem CID 19450312) has the molecular formula C22H21BrN2O6S and a molecular weight of 521.39 g/mol. Its IUPAC name is 5-[(2-bromophenoxy)methyl]-N-(4-morpholin-4-ylsulfonylphenyl)furan-2-carboxamide.
| Compound Name | 5-[(2-bromophenoxy)methyl]-N-(4-morpholin-4-ylsulfonylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19450312 |
| Molecular Formula | C22H21BrN2O6S |
| Molecular Weight | 521.39 g/mol |
| Exact Mass | 520.03 |
| IUPAC Name | 5-[(2-bromophenoxy)methyl]-N-(4-morpholin-4-ylsulfonylphenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCOCC2)cc1)c1ccc(COc2ccccc2Br)o1 |
| InChI | InChI=1S/C22H21BrN2O6S/c23-19-3-1-2-4-20(19)30-15-17-7-10-21(31-17)22(26)24-16-5-8-18(9-6-16)32(27,28)25-11-13-29-14-12-25/h1-10H,11-15H2,(H,24,26) |
| InChIKey | PLKRFIVYNDKDLT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |