C17H27N3O2 — CID 170888915
ethyl 1-[5-(2-aminobutyl)-2-pyridinyl]piperidine-4-carboxylate (PubChem CID 170888915) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is ethyl 1-[5-(2-aminobutyl)-2-pyridinyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-(2-aminobutyl)-2-pyridinyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 170888915 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | ethyl 1-[5-(2-aminobutyl)-2-pyridinyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc(CC(N)CC)cn2)CC1 |
| InChI | InChI=1S/C17H27N3O2/c1-3-15(18)11-13-5-6-16(19-12-13)20-9-7-14(8-10-20)17(21)22-4-2/h5-6,12,14-15H,3-4,7-11,18H2,1-2H3 |
| InChIKey | MCZDUNQFKPJUDD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |