C21H31N3O — CID 170889788
2-[3-(2-aminobutyl)-2-methylindol-1-yl]-1-(2-methylpiperidin-1-yl)ethanone (PubChem CID 170889788) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is 2-[3-(2-aminobutyl)-2-methylindol-1-yl]-1-(2-methylpiperidin-1-yl)ethanone.
| Compound Name | 2-[3-(2-aminobutyl)-2-methylindol-1-yl]-1-(2-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 170889788 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | 2-[3-(2-aminobutyl)-2-methylindol-1-yl]-1-(2-methylpiperidin-1-yl)ethanone |
| SMILES | CCC(N)Cc1c(C)n(CC(=O)N2CCCCC2C)c2ccccc12 |
| InChI | InChI=1S/C21H31N3O/c1-4-17(22)13-19-16(3)24(20-11-6-5-10-18(19)20)14-21(25)23-12-8-7-9-15(23)2/h5-6,10-11,15,17H,4,7-9,12-14,22H2,1-3H3 |
| InChIKey | UYNCUZPZLQMHMK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|