C22H26ClN3O — CID 170893839
2-[3-(2-aminopropyl)-2-methylindol-1-yl]-1-(2,3-dihydroindol-1-yl)ethanone;hydrochloride (PubChem CID 170893839) has the molecular formula C22H26ClN3O and a molecular weight of 383.92 g/mol. Its IUPAC name is 2-[3-(2-aminopropyl)-2-methylindol-1-yl]-1-(2,3-dihydroindol-1-yl)ethanone;hydrochloride.
| Compound Name | 2-[3-(2-aminopropyl)-2-methylindol-1-yl]-1-(2,3-dihydroindol-1-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 170893839 |
| Molecular Formula | C22H26ClN3O |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-[3-(2-aminopropyl)-2-methylindol-1-yl]-1-(2,3-dihydroindol-1-yl)ethanone;hydrochloride |
| SMILES | Cc1c(CC(C)N)c2ccccc2n1CC(=O)N1CCc2ccccc21.Cl |
| InChI | InChI=1S/C22H25N3O.ClH/c1-15(23)13-19-16(2)25(21-10-6-4-8-18(19)21)14-22(26)24-12-11-17-7-3-5-9-20(17)24;/h3-10,15H,11-14,23H2,1-2H3;1H |
| InChIKey | OWGFHCPMABBKKP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|