C18H15N3O2 — CID 2425815
1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]quinoxalin-2-one (PubChem CID 2425815) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]quinoxalin-2-one.
| Compound Name | 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]quinoxalin-2-one |
|---|---|
| PubChem CID | 2425815 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]quinoxalin-2-one |
| SMILES | O=C(Cn1c(=O)cnc2ccccc21)N1CCc2ccccc21 |
| InChI | InChI=1S/C18H15N3O2/c22-17-11-19-14-6-2-4-8-16(14)21(17)12-18(23)20-10-9-13-5-1-3-7-15(13)20/h1-8,11H,9-10,12H2 |
| InChIKey | GRGZMLYSEQDOAZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |