C25H22N4O2 — CID 55895462
N-[2-(2,3-dihydroindol-1-ylmethyl)phenyl]-2-(2-oxoquinoxalin-1-yl)acetamide (PubChem CID 55895462) has the molecular formula C25H22N4O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is N-[2-(2,3-dihydroindol-1-ylmethyl)phenyl]-2-(2-oxoquinoxalin-1-yl)acetamide.
| Compound Name | N-[2-(2,3-dihydroindol-1-ylmethyl)phenyl]-2-(2-oxoquinoxalin-1-yl)acetamide |
|---|---|
| PubChem CID | 55895462 |
| Molecular Formula | C25H22N4O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | N-[2-(2,3-dihydroindol-1-ylmethyl)phenyl]-2-(2-oxoquinoxalin-1-yl)acetamide |
| SMILES | O=C(Cn1c(=O)cnc2ccccc21)Nc1ccccc1CN1CCc2ccccc21 |
| InChI | InChI=1S/C25H22N4O2/c30-24(17-29-23-12-6-4-10-21(23)26-15-25(29)31)27-20-9-3-1-8-19(20)16-28-14-13-18-7-2-5-11-22(18)28/h1-12,15H,13-14,16-17H2,(H,27,30) |
| InChIKey | NVUVUJYIMNYVRS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |