C20H31Cl2NO — CID 170889959
1-[5-chloro-3-cyclohexyl-2-(cyclopropylmethoxy)phenyl]butan-2-amine;hydrochloride (PubChem CID 170889959) has the molecular formula C20H31Cl2NO and a molecular weight of 372.38 g/mol. Its IUPAC name is 1-[5-chloro-3-cyclohexyl-2-(cyclopropylmethoxy)phenyl]butan-2-amine;hydrochloride.
| Compound Name | 1-[5-chloro-3-cyclohexyl-2-(cyclopropylmethoxy)phenyl]butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170889959 |
| Molecular Formula | C20H31Cl2NO |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 1-[5-chloro-3-cyclohexyl-2-(cyclopropylmethoxy)phenyl]butan-2-amine;hydrochloride |
| SMILES | CCC(N)Cc1cc(Cl)cc(C2CCCCC2)c1OCC1CC1.Cl |
| InChI | InChI=1S/C20H30ClNO.ClH/c1-2-18(22)11-16-10-17(21)12-19(15-6-4-3-5-7-15)20(16)23-13-14-8-9-14;/h10,12,14-15,18H,2-9,11,13,22H2,1H3;1H |
| InChIKey | JHXTWPXZEVDLNV-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |