C14H21ClN2 — CID 170890669
1-(1,7-dimethylindol-2-yl)butan-2-amine;hydrochloride (PubChem CID 170890669) has the molecular formula C14H21ClN2 and a molecular weight of 252.79 g/mol. Its IUPAC name is 1-(1,7-dimethylindol-2-yl)butan-2-amine;hydrochloride.
| Compound Name | 1-(1,7-dimethylindol-2-yl)butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170890669 |
| Molecular Formula | C14H21ClN2 |
| Molecular Weight | 252.79 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 1-(1,7-dimethylindol-2-yl)butan-2-amine;hydrochloride |
| SMILES | CCC(N)Cc1cc2cccc(C)c2n1C.Cl |
| InChI | InChI=1S/C14H20N2.ClH/c1-4-12(15)9-13-8-11-7-5-6-10(2)14(11)16(13)3;/h5-8,12H,4,9,15H2,1-3H3;1H |
| InChIKey | XFQQWBWQORKIBN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.79 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |