C19H29N5 — CID 170890877
3,5-bis(2-aminobutyl)-4-phenylpyridine-2,6-diamine (PubChem CID 170890877) has the molecular formula C19H29N5 and a molecular weight of 327.48 g/mol. Its IUPAC name is 3,5-bis(2-aminobutyl)-4-phenylpyridine-2,6-diamine.
| Compound Name | 3,5-bis(2-aminobutyl)-4-phenylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 170890877 |
| Molecular Formula | C19H29N5 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | 3,5-bis(2-aminobutyl)-4-phenylpyridine-2,6-diamine |
| SMILES | CCC(N)Cc1c(N)nc(N)c(CC(N)CC)c1-c1ccccc1 |
| InChI | InChI=1S/C19H29N5/c1-3-13(20)10-15-17(12-8-6-5-7-9-12)16(11-14(21)4-2)19(23)24-18(15)22/h5-9,13-14H,3-4,10-11,20-21H2,1-2H3,(H4,22,23,24) |
| InChIKey | QRYNQOMNPGLYDN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 116.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |