C13H16N2O — CID 66200306
5-butan-2-yl-4-phenyl-1,2-oxazol-3-amine (PubChem CID 66200306) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 5-butan-2-yl-4-phenyl-1,2-oxazol-3-amine.
| Compound Name | 5-butan-2-yl-4-phenyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66200306 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 5-butan-2-yl-4-phenyl-1,2-oxazol-3-amine |
| SMILES | CCC(C)c1onc(N)c1-c1ccccc1 |
| InChI | InChI=1S/C13H16N2O/c1-3-9(2)12-11(13(14)15-16-12)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3,(H2,14,15) |
| InChIKey | IXYOOTHURFAFII-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |