About ethyl 5-(2-aminopropyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate
ethyl 5-(2-aminopropyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 170890916) has the molecular formula C12H20N2O2
and a molecular weight of 224.30 g/mol. Its IUPAC name is ethyl 5-(2-aminopropyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate.
Analyze ethyl 5-(2-aminopropyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(2-aminopropyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate?
The IUPAC name of ethyl 5-(2-aminopropyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate (CID 170890916) is ethyl 5-(2-aminopropyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate.
What is the SMILES notation for ethyl 5-(2-aminopropyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate?
The canonical SMILES for ethyl 5-(2-aminopropyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate is CCOC(=O)c1c(C)[nH]c(CC(C)N)c1C.
What is the InChIKey of ethyl 5-(2-aminopropyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate?
The InChIKey is XGZISMZGTXDWJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2/c1-5-16-12(15)11-8(3)10(6-7(2)13)14-9(11)4/h7,14H,5-6,13H2,1-4H3.
What are the key properties of ethyl 5-(2-aminopropyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate?
ethyl 5-(2-aminopropyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate has a molecular weight of 224.30 g/mol, XLogP of 1.70, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(2-aminopropyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate is sourced from PubChem (CID 170890916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).