C14H16ClF3N2O — CID 170892592
2-amino-3-[1-[4-(trifluoromethyl)phenyl]pyrrol-2-yl]propan-1-ol;hydrochloride (PubChem CID 170892592) has the molecular formula C14H16ClF3N2O and a molecular weight of 320.74 g/mol. Its IUPAC name is 2-amino-3-[1-[4-(trifluoromethyl)phenyl]pyrrol-2-yl]propan-1-ol;hydrochloride.
| Compound Name | 2-amino-3-[1-[4-(trifluoromethyl)phenyl]pyrrol-2-yl]propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 170892592 |
| Molecular Formula | C14H16ClF3N2O |
| Molecular Weight | 320.74 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-amino-3-[1-[4-(trifluoromethyl)phenyl]pyrrol-2-yl]propan-1-ol;hydrochloride |
| SMILES | Cl.NC(CO)Cc1cccn1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H15F3N2O.ClH/c15-14(16,17)10-3-5-12(6-4-10)19-7-1-2-13(19)8-11(18)9-20;/h1-7,11,20H,8-9,18H2;1H |
| InChIKey | VXVWCTIRCKORKX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.74 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |