C15H15Cl2NO2 — CID 170893180
2-amino-3-[3-(3,5-dichlorophenoxy)phenyl]propan-1-ol (PubChem CID 170893180) has the molecular formula C15H15Cl2NO2 and a molecular weight of 312.20 g/mol. Its IUPAC name is 2-amino-3-[3-(3,5-dichlorophenoxy)phenyl]propan-1-ol.
| Compound Name | 2-amino-3-[3-(3,5-dichlorophenoxy)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 170893180 |
| Molecular Formula | C15H15Cl2NO2 |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 2-amino-3-[3-(3,5-dichlorophenoxy)phenyl]propan-1-ol |
| SMILES | NC(CO)Cc1cccc(Oc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C15H15Cl2NO2/c16-11-6-12(17)8-15(7-11)20-14-3-1-2-10(5-14)4-13(18)9-19/h1-3,5-8,13,19H,4,9,18H2 |
| InChIKey | KRLCJFUTZIWKHW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |