C15H24ClNO3 — CID 170893568
2-amino-3-[4-(3-methoxyphenyl)oxan-4-yl]propan-1-ol;hydrochloride (PubChem CID 170893568) has the molecular formula C15H24ClNO3 and a molecular weight of 301.81 g/mol. Its IUPAC name is 2-amino-3-[4-(3-methoxyphenyl)oxan-4-yl]propan-1-ol;hydrochloride.
| Compound Name | 2-amino-3-[4-(3-methoxyphenyl)oxan-4-yl]propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 170893568 |
| Molecular Formula | C15H24ClNO3 |
| Molecular Weight | 301.81 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-amino-3-[4-(3-methoxyphenyl)oxan-4-yl]propan-1-ol;hydrochloride |
| SMILES | COc1cccc(C2(CC(N)CO)CCOCC2)c1.Cl |
| InChI | InChI=1S/C15H23NO3.ClH/c1-18-14-4-2-3-12(9-14)15(10-13(16)11-17)5-7-19-8-6-15;/h2-4,9,13,17H,5-8,10-11,16H2,1H3;1H |
| InChIKey | QSXVCUVCLRRQGT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.81 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |