C7H14ClN3 — CID 170893704
1-(5-methyl-1H-pyrazol-3-yl)propan-2-amine;hydrochloride (PubChem CID 170893704) has the molecular formula C7H14ClN3 and a molecular weight of 175.66 g/mol. Its IUPAC name is 1-(5-methyl-1H-pyrazol-3-yl)propan-2-amine;hydrochloride.
| Compound Name | 1-(5-methyl-1H-pyrazol-3-yl)propan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170893704 |
| Molecular Formula | C7H14ClN3 |
| Molecular Weight | 175.66 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | 1-(5-methyl-1H-pyrazol-3-yl)propan-2-amine;hydrochloride |
| SMILES | Cc1cc(CC(C)N)n[nH]1.Cl |
| InChI | InChI=1S/C7H13N3.ClH/c1-5(8)3-7-4-6(2)9-10-7;/h4-5H,3,8H2,1-2H3,(H,9,10);1H |
| InChIKey | JDIIHRWKCRNANV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.66 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |