C15H25Cl2NO — CID 170894041
1-[3-chloro-2-methoxy-5-(2-methylbutan-2-yl)phenyl]propan-2-amine;hydrochloride (PubChem CID 170894041) has the molecular formula C15H25Cl2NO and a molecular weight of 306.28 g/mol. Its IUPAC name is 1-[3-chloro-2-methoxy-5-(2-methylbutan-2-yl)phenyl]propan-2-amine;hydrochloride.
| Compound Name | 1-[3-chloro-2-methoxy-5-(2-methylbutan-2-yl)phenyl]propan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170894041 |
| Molecular Formula | C15H25Cl2NO |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 1-[3-chloro-2-methoxy-5-(2-methylbutan-2-yl)phenyl]propan-2-amine;hydrochloride |
| SMILES | CCC(C)(C)c1cc(Cl)c(OC)c(CC(C)N)c1.Cl |
| InChI | InChI=1S/C15H24ClNO.ClH/c1-6-15(3,4)12-8-11(7-10(2)17)14(18-5)13(16)9-12;/h8-10H,6-7,17H2,1-5H3;1H |
| InChIKey | ACMNNIWZYBCUOA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |