C14H23Cl2NO2 — CID 170890086
1-[3-chloro-5-(ethoxymethyl)-2-methoxyphenyl]butan-2-amine;hydrochloride (PubChem CID 170890086) has the molecular formula C14H23Cl2NO2 and a molecular weight of 308.25 g/mol. Its IUPAC name is 1-[3-chloro-5-(ethoxymethyl)-2-methoxyphenyl]butan-2-amine;hydrochloride.
| Compound Name | 1-[3-chloro-5-(ethoxymethyl)-2-methoxyphenyl]butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170890086 |
| Molecular Formula | C14H23Cl2NO2 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 1-[3-chloro-5-(ethoxymethyl)-2-methoxyphenyl]butan-2-amine;hydrochloride |
| SMILES | CCOCc1cc(Cl)c(OC)c(CC(N)CC)c1.Cl |
| InChI | InChI=1S/C14H22ClNO2.ClH/c1-4-12(16)8-11-6-10(9-18-5-2)7-13(15)14(11)17-3;/h6-7,12H,4-5,8-9,16H2,1-3H3;1H |
| InChIKey | AEUVUEFAMOIALM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |