C17H27Cl2NO2 — CID 170893967
1-[3-chloro-5-(cyclopropylmethoxymethyl)-2-propoxyphenyl]propan-2-amine;hydrochloride (PubChem CID 170893967) has the molecular formula C17H27Cl2NO2 and a molecular weight of 348.31 g/mol. Its IUPAC name is 1-[3-chloro-5-(cyclopropylmethoxymethyl)-2-propoxyphenyl]propan-2-amine;hydrochloride.
| Compound Name | 1-[3-chloro-5-(cyclopropylmethoxymethyl)-2-propoxyphenyl]propan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170893967 |
| Molecular Formula | C17H27Cl2NO2 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 1-[3-chloro-5-(cyclopropylmethoxymethyl)-2-propoxyphenyl]propan-2-amine;hydrochloride |
| SMILES | CCCOc1c(Cl)cc(COCC2CC2)cc1CC(C)N.Cl |
| InChI | InChI=1S/C17H26ClNO2.ClH/c1-3-6-21-17-15(7-12(2)19)8-14(9-16(17)18)11-20-10-13-4-5-13;/h8-9,12-13H,3-7,10-11,19H2,1-2H3;1H |
| InChIKey | SJARLRYNKKOHQO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |