C15H25Cl2NO2 — CID 170890050
1-[3-chloro-2-ethoxy-5-(ethoxymethyl)phenyl]butan-2-amine;hydrochloride (PubChem CID 170890050) has the molecular formula C15H25Cl2NO2 and a molecular weight of 322.28 g/mol. Its IUPAC name is 1-[3-chloro-2-ethoxy-5-(ethoxymethyl)phenyl]butan-2-amine;hydrochloride.
| Compound Name | 1-[3-chloro-2-ethoxy-5-(ethoxymethyl)phenyl]butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170890050 |
| Molecular Formula | C15H25Cl2NO2 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 1-[3-chloro-2-ethoxy-5-(ethoxymethyl)phenyl]butan-2-amine;hydrochloride |
| SMILES | CCOCc1cc(Cl)c(OCC)c(CC(N)CC)c1.Cl |
| InChI | InChI=1S/C15H24ClNO2.ClH/c1-4-13(17)9-12-7-11(10-18-5-2)8-14(16)15(12)19-6-3;/h7-8,13H,4-6,9-10,17H2,1-3H3;1H |
| InChIKey | CGMASCCYWURINB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |