C14H22ClNO — CID 170890049
1-(5-chloro-4-ethoxy-2,3-dimethylphenyl)butan-2-amine (PubChem CID 170890049) has the molecular formula C14H22ClNO and a molecular weight of 255.79 g/mol. Its IUPAC name is 1-(5-chloro-4-ethoxy-2,3-dimethylphenyl)butan-2-amine.
| Compound Name | 1-(5-chloro-4-ethoxy-2,3-dimethylphenyl)butan-2-amine |
|---|---|
| PubChem CID | 170890049 |
| Molecular Formula | C14H22ClNO |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 1-(5-chloro-4-ethoxy-2,3-dimethylphenyl)butan-2-amine |
| SMILES | CCOc1c(Cl)cc(CC(N)CC)c(C)c1C |
| InChI | InChI=1S/C14H22ClNO/c1-5-12(16)7-11-8-13(15)14(17-6-2)10(4)9(11)3/h8,12H,5-7,16H2,1-4H3 |
| InChIKey | YICYOUDIYQPKMV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |